C21H23N3O3 — CID 108872468
1-[2-(2-methylpropyl)-1,3-dioxoisoindol-5-yl]-3-(1-phenylethyl)urea (PubChem CID 108872468) has the molecular formula C21H23N3O3 and a molecular weight of 365.43 g/mol. Its IUPAC name is 1-[2-(2-methylpropyl)-1,3-dioxoisoindol-5-yl]-3-(1-phenylethyl)urea.
| Compound Name | 1-[2-(2-methylpropyl)-1,3-dioxoisoindol-5-yl]-3-(1-phenylethyl)urea |
|---|---|
| PubChem CID | 108872468 |
| Molecular Formula | C21H23N3O3 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | 1-[2-(2-methylpropyl)-1,3-dioxoisoindol-5-yl]-3-(1-phenylethyl)urea |
| SMILES | CC(C)CN1C(=O)c2ccc(NC(=O)NC(C)c3ccccc3)cc2C1=O |
| InChI | InChI=1S/C21H23N3O3/c1-13(2)12-24-19(25)17-10-9-16(11-18(17)20(24)26)23-21(27)22-14(3)15-7-5-4-6-8-15/h4-11,13-14H,12H2,1-3H3,(H2,22,23,27) |
| InChIKey | DMOASNGVYGDGLL-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|