C25H23N3O3S — CID 108872514
1-[2-(2-methylpropyl)-1,3-dioxoisoindol-5-yl]-3-(2-phenylsulfanylphenyl)urea (PubChem CID 108872514) has the molecular formula C25H23N3O3S and a molecular weight of 445.54 g/mol. Its IUPAC name is 1-[2-(2-methylpropyl)-1,3-dioxoisoindol-5-yl]-3-(2-phenylsulfanylphenyl)urea.
| Compound Name | 1-[2-(2-methylpropyl)-1,3-dioxoisoindol-5-yl]-3-(2-phenylsulfanylphenyl)urea |
|---|---|
| PubChem CID | 108872514 |
| Molecular Formula | C25H23N3O3S |
| Molecular Weight | 445.54 g/mol |
| Exact Mass | 445.15 |
| IUPAC Name | 1-[2-(2-methylpropyl)-1,3-dioxoisoindol-5-yl]-3-(2-phenylsulfanylphenyl)urea |
| SMILES | CC(C)CN1C(=O)c2ccc(NC(=O)Nc3ccccc3Sc3ccccc3)cc2C1=O |
| InChI | InChI=1S/C25H23N3O3S/c1-16(2)15-28-23(29)19-13-12-17(14-20(19)24(28)30)26-25(31)27-21-10-6-7-11-22(21)32-18-8-4-3-5-9-18/h3-14,16H,15H2,1-2H3,(H2,26,27,31) |
| InChIKey | AXNYDDVKQOPWHX-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.54 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|