C21H21N3O4S — CID 7558012
2-[3-(2-methylpropyl)-2,4,5-trioxoimidazolidin-1-yl]-N-(2-phenylsulfanylphenyl)acetamide (PubChem CID 7558012) has the molecular formula C21H21N3O4S and a molecular weight of 411.48 g/mol. Its IUPAC name is 2-[3-(2-methylpropyl)-2,4,5-trioxoimidazolidin-1-yl]-N-(2-phenylsulfanylphenyl)acetamide.
| Compound Name | 2-[3-(2-methylpropyl)-2,4,5-trioxoimidazolidin-1-yl]-N-(2-phenylsulfanylphenyl)acetamide |
|---|---|
| PubChem CID | 7558012 |
| Molecular Formula | C21H21N3O4S |
| Molecular Weight | 411.48 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | 2-[3-(2-methylpropyl)-2,4,5-trioxoimidazolidin-1-yl]-N-(2-phenylsulfanylphenyl)acetamide |
| SMILES | CC(C)CN1C(=O)C(=O)N(CC(=O)Nc2ccccc2Sc2ccccc2)C1=O |
| InChI | InChI=1S/C21H21N3O4S/c1-14(2)12-23-19(26)20(27)24(21(23)28)13-18(25)22-16-10-6-7-11-17(16)29-15-8-4-3-5-9-15/h3-11,14H,12-13H2,1-2H3,(H,22,25) |
| InChIKey | CHJVVFAAEZEMDD-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.48 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|