C15H17N3O4 — CID 2574725
2-[3-(2-methylpropyl)-2,4,5-trioxoimidazolidin-1-yl]-N-phenylacetamide (PubChem CID 2574725) has the molecular formula C15H17N3O4 and a molecular weight of 303.32 g/mol. Its IUPAC name is 2-[3-(2-methylpropyl)-2,4,5-trioxoimidazolidin-1-yl]-N-phenylacetamide.
| Compound Name | 2-[3-(2-methylpropyl)-2,4,5-trioxoimidazolidin-1-yl]-N-phenylacetamide |
|---|---|
| PubChem CID | 2574725 |
| Molecular Formula | C15H17N3O4 |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | 2-[3-(2-methylpropyl)-2,4,5-trioxoimidazolidin-1-yl]-N-phenylacetamide |
| SMILES | CC(C)CN1C(=O)C(=O)N(CC(=O)Nc2ccccc2)C1=O |
| InChI | InChI=1S/C15H17N3O4/c1-10(2)8-17-13(20)14(21)18(15(17)22)9-12(19)16-11-6-4-3-5-7-11/h3-7,10H,8-9H2,1-2H3,(H,16,19) |
| InChIKey | JUJYWBBZFYKSGX-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|