C16H27N3O4 — CID 8889120
N-[(2S)-5-methylhexan-2-yl]-2-[3-(2-methylpropyl)-2,4,5-trioxoimidazolidin-1-yl]acetamide (PubChem CID 8889120) has the molecular formula C16H27N3O4 and a molecular weight of 325.41 g/mol. Its IUPAC name is N-[(2S)-5-methylhexan-2-yl]-2-[3-(2-methylpropyl)-2,4,5-trioxoimidazolidin-1-yl]acetamide.
| Compound Name | N-[(2S)-5-methylhexan-2-yl]-2-[3-(2-methylpropyl)-2,4,5-trioxoimidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 8889120 |
| Molecular Formula | C16H27N3O4 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.20 |
| IUPAC Name | N-[(2S)-5-methylhexan-2-yl]-2-[3-(2-methylpropyl)-2,4,5-trioxoimidazolidin-1-yl]acetamide |
| SMILES | CC(C)CC[C@H](C)NC(=O)CN1C(=O)C(=O)N(CC(C)C)C1=O |
| InChI | InChI=1S/C16H27N3O4/c1-10(2)6-7-12(5)17-13(20)9-19-15(22)14(21)18(16(19)23)8-11(3)4/h10-12H,6-9H2,1-5H3,(H,17,20)/t12-/m0/s1 |
| InChIKey | XCZVRZDASLEHMG-LBPRGKRZSA-N |
| XLogP | 1.37 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|