C22H17N3O5S — CID 4782480
2-[3-(furan-2-ylmethyl)-2,4,5-trioxoimidazolidin-1-yl]-N-(2-phenylsulfanylphenyl)acetamide (PubChem CID 4782480) has the molecular formula C22H17N3O5S and a molecular weight of 435.46 g/mol. Its IUPAC name is 2-[3-(furan-2-ylmethyl)-2,4,5-trioxoimidazolidin-1-yl]-N-(2-phenylsulfanylphenyl)acetamide.
| Compound Name | 2-[3-(furan-2-ylmethyl)-2,4,5-trioxoimidazolidin-1-yl]-N-(2-phenylsulfanylphenyl)acetamide |
|---|---|
| PubChem CID | 4782480 |
| Molecular Formula | C22H17N3O5S |
| Molecular Weight | 435.46 g/mol |
| Exact Mass | 435.09 |
| IUPAC Name | 2-[3-(furan-2-ylmethyl)-2,4,5-trioxoimidazolidin-1-yl]-N-(2-phenylsulfanylphenyl)acetamide |
| SMILES | O=C(CN1C(=O)C(=O)N(Cc2ccco2)C1=O)Nc1ccccc1Sc1ccccc1 |
| InChI | InChI=1S/C22H17N3O5S/c26-19(23-17-10-4-5-11-18(17)31-16-8-2-1-3-9-16)14-25-21(28)20(27)24(22(25)29)13-15-7-6-12-30-15/h1-12H,13-14H2,(H,23,26) |
| InChIKey | VZDKYEFVKRGIGQ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.46 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|