C16H21N3O6 — CID 9374714
2-[3-(furan-2-ylmethyl)-2,4,5-trioxoimidazolidin-1-yl]-N-(3-propan-2-yloxypropyl)acetamide (PubChem CID 9374714) has the molecular formula C16H21N3O6 and a molecular weight of 351.36 g/mol. Its IUPAC name is 2-[3-(furan-2-ylmethyl)-2,4,5-trioxoimidazolidin-1-yl]-N-(3-propan-2-yloxypropyl)acetamide.
| Compound Name | 2-[3-(furan-2-ylmethyl)-2,4,5-trioxoimidazolidin-1-yl]-N-(3-propan-2-yloxypropyl)acetamide |
|---|---|
| PubChem CID | 9374714 |
| Molecular Formula | C16H21N3O6 |
| Molecular Weight | 351.36 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | 2-[3-(furan-2-ylmethyl)-2,4,5-trioxoimidazolidin-1-yl]-N-(3-propan-2-yloxypropyl)acetamide |
| SMILES | CC(C)OCCCNC(=O)CN1C(=O)C(=O)N(Cc2ccco2)C1=O |
| InChI | InChI=1S/C16H21N3O6/c1-11(2)24-8-4-6-17-13(20)10-19-15(22)14(21)18(16(19)23)9-12-5-3-7-25-12/h3,5,7,11H,4,6,8-10H2,1-2H3,(H,17,20) |
| InChIKey | ZHAWGEHVRLUTMD-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 109.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.36 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|