C19H20N4O3 — CID 108872704
1-[2-(2-methylpropyl)-1,3-dioxoisoindol-5-yl]-3-(4-methyl-2-pyridinyl)urea (PubChem CID 108872704) has the molecular formula C19H20N4O3 and a molecular weight of 352.39 g/mol. Its IUPAC name is 1-[2-(2-methylpropyl)-1,3-dioxoisoindol-5-yl]-3-(4-methyl-2-pyridinyl)urea.
| Compound Name | 1-[2-(2-methylpropyl)-1,3-dioxoisoindol-5-yl]-3-(4-methyl-2-pyridinyl)urea |
|---|---|
| PubChem CID | 108872704 |
| Molecular Formula | C19H20N4O3 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | 1-[2-(2-methylpropyl)-1,3-dioxoisoindol-5-yl]-3-(4-methyl-2-pyridinyl)urea |
| SMILES | Cc1ccnc(NC(=O)Nc2ccc3c(c2)C(=O)N(CC(C)C)C3=O)c1 |
| InChI | InChI=1S/C19H20N4O3/c1-11(2)10-23-17(24)14-5-4-13(9-15(14)18(23)25)21-19(26)22-16-8-12(3)6-7-20-16/h4-9,11H,10H2,1-3H3,(H2,20,21,22,26) |
| InChIKey | NSYYZPLZOBTVLD-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|