C17H16BrN5O3 — CID 108872755
1-(5-bromopyrimidin-2-yl)-3-[2-(2-methylpropyl)-1,3-dioxoisoindol-5-yl]urea (PubChem CID 108872755) has the molecular formula C17H16BrN5O3 and a molecular weight of 418.25 g/mol. Its IUPAC name is 1-(5-bromopyrimidin-2-yl)-3-[2-(2-methylpropyl)-1,3-dioxoisoindol-5-yl]urea.
| Compound Name | 1-(5-bromopyrimidin-2-yl)-3-[2-(2-methylpropyl)-1,3-dioxoisoindol-5-yl]urea |
|---|---|
| PubChem CID | 108872755 |
| Molecular Formula | C17H16BrN5O3 |
| Molecular Weight | 418.25 g/mol |
| Exact Mass | 417.04 |
| IUPAC Name | 1-(5-bromopyrimidin-2-yl)-3-[2-(2-methylpropyl)-1,3-dioxoisoindol-5-yl]urea |
| SMILES | CC(C)CN1C(=O)c2ccc(NC(=O)Nc3ncc(Br)cn3)cc2C1=O |
| InChI | InChI=1S/C17H16BrN5O3/c1-9(2)8-23-14(24)12-4-3-11(5-13(12)15(23)25)21-17(26)22-16-19-6-10(18)7-20-16/h3-7,9H,8H2,1-2H3,(H2,19,20,21,22,26) |
| InChIKey | AAZTYOXFZBKYMQ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.25 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|