C17H23N3O5 — CID 108872480
1,1-bis(2-hydroxyethyl)-3-[2-(2-methylpropyl)-1,3-dioxoisoindol-5-yl]urea (PubChem CID 108872480) has the molecular formula C17H23N3O5 and a molecular weight of 349.39 g/mol. Its IUPAC name is 1,1-bis(2-hydroxyethyl)-3-[2-(2-methylpropyl)-1,3-dioxoisoindol-5-yl]urea.
| Compound Name | 1,1-bis(2-hydroxyethyl)-3-[2-(2-methylpropyl)-1,3-dioxoisoindol-5-yl]urea |
|---|---|
| PubChem CID | 108872480 |
| Molecular Formula | C17H23N3O5 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | 1,1-bis(2-hydroxyethyl)-3-[2-(2-methylpropyl)-1,3-dioxoisoindol-5-yl]urea |
| SMILES | CC(C)CN1C(=O)c2ccc(NC(=O)N(CCO)CCO)cc2C1=O |
| InChI | InChI=1S/C17H23N3O5/c1-11(2)10-20-15(23)13-4-3-12(9-14(13)16(20)24)18-17(25)19(5-7-21)6-8-22/h3-4,9,11,21-22H,5-8,10H2,1-2H3,(H,18,25) |
| InChIKey | KHZLOINJRALBGQ-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 110.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|