C19H25N3O5S — CID 108872608
1-(1,1-dioxothiolan-3-yl)-1-ethyl-3-[2-(2-methylpropyl)-1,3-dioxoisoindol-5-yl]urea (PubChem CID 108872608) has the molecular formula C19H25N3O5S and a molecular weight of 407.49 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-1-ethyl-3-[2-(2-methylpropyl)-1,3-dioxoisoindol-5-yl]urea.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-1-ethyl-3-[2-(2-methylpropyl)-1,3-dioxoisoindol-5-yl]urea |
|---|---|
| PubChem CID | 108872608 |
| Molecular Formula | C19H25N3O5S |
| Molecular Weight | 407.49 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-1-ethyl-3-[2-(2-methylpropyl)-1,3-dioxoisoindol-5-yl]urea |
| SMILES | CCN(C(=O)Nc1ccc2c(c1)C(=O)N(CC(C)C)C2=O)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C19H25N3O5S/c1-4-21(14-7-8-28(26,27)11-14)19(25)20-13-5-6-15-16(9-13)18(24)22(17(15)23)10-12(2)3/h5-6,9,12,14H,4,7-8,10-11H2,1-3H3,(H,20,25) |
| InChIKey | KRUPTDQCVIUZPM-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.49 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|