C22H28N2O7S — CID 26007947
[(2R)-1-[[(3S)-1,1-dioxothiolan-3-yl]-ethylamino]-1-oxopropan-2-yl] 2-butyl-1,3-dioxoisoindole-5-carboxylate (PubChem CID 26007947) has the molecular formula C22H28N2O7S and a molecular weight of 464.54 g/mol. Its IUPAC name is [(2R)-1-[[(3S)-1,1-dioxothiolan-3-yl]-ethylamino]-1-oxopropan-2-yl] 2-butyl-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | [(2R)-1-[[(3S)-1,1-dioxothiolan-3-yl]-ethylamino]-1-oxopropan-2-yl] 2-butyl-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 26007947 |
| Molecular Formula | C22H28N2O7S |
| Molecular Weight | 464.54 g/mol |
| Exact Mass | 464.16 |
| IUPAC Name | [(2R)-1-[[(3S)-1,1-dioxothiolan-3-yl]-ethylamino]-1-oxopropan-2-yl] 2-butyl-1,3-dioxoisoindole-5-carboxylate |
| SMILES | CCCCN1C(=O)c2ccc(C(=O)O[C@H](C)C(=O)N(CC)[C@H]3CCS(=O)(=O)C3)cc2C1=O |
| InChI | InChI=1S/C22H28N2O7S/c1-4-6-10-24-20(26)17-8-7-15(12-18(17)21(24)27)22(28)31-14(3)19(25)23(5-2)16-9-11-32(29,30)13-16/h7-8,12,14,16H,4-6,9-11,13H2,1-3H3/t14-,16+/m1/s1 |
| InChIKey | FMFLMLNYJQAGLS-ZBFHGGJFSA-N |
| XLogP | 1.66 |
| TPSA | 118.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.54 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|