C21H24N2O7S — CID 26007879
[(2S)-1-[[(3S)-1,1-dioxothiolan-3-yl]-ethylamino]-1-oxopropan-2-yl] 1,3-dioxo-2-prop-2-enylisoindole-5-carboxylate (PubChem CID 26007879) has the molecular formula C21H24N2O7S and a molecular weight of 448.50 g/mol. Its IUPAC name is [(2S)-1-[[(3S)-1,1-dioxothiolan-3-yl]-ethylamino]-1-oxopropan-2-yl] 1,3-dioxo-2-prop-2-enylisoindole-5-carboxylate.
| Compound Name | [(2S)-1-[[(3S)-1,1-dioxothiolan-3-yl]-ethylamino]-1-oxopropan-2-yl] 1,3-dioxo-2-prop-2-enylisoindole-5-carboxylate |
|---|---|
| PubChem CID | 26007879 |
| Molecular Formula | C21H24N2O7S |
| Molecular Weight | 448.50 g/mol |
| Exact Mass | 448.13 |
| IUPAC Name | [(2S)-1-[[(3S)-1,1-dioxothiolan-3-yl]-ethylamino]-1-oxopropan-2-yl] 1,3-dioxo-2-prop-2-enylisoindole-5-carboxylate |
| SMILES | C=CCN1C(=O)c2ccc(C(=O)O[C@@H](C)C(=O)N(CC)[C@H]3CCS(=O)(=O)C3)cc2C1=O |
| InChI | InChI=1S/C21H24N2O7S/c1-4-9-23-19(25)16-7-6-14(11-17(16)20(23)26)21(27)30-13(3)18(24)22(5-2)15-8-10-31(28,29)12-15/h4,6-7,11,13,15H,1,5,8-10,12H2,2-3H3/t13-,15-/m0/s1 |
| InChIKey | ZPEYCIOAXPCFRJ-ZFWWWQNUSA-N |
| XLogP | 1.05 |
| TPSA | 118.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.50 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|