C19H20N2O7S — CID 41179156
[2-[[(3S)-1,1-dioxothiolan-3-yl]-methylamino]-2-oxoethyl] 1,3-dioxo-2-prop-2-enylisoindole-5-carboxylate (PubChem CID 41179156) has the molecular formula C19H20N2O7S and a molecular weight of 420.44 g/mol. Its IUPAC name is [2-[[(3S)-1,1-dioxothiolan-3-yl]-methylamino]-2-oxoethyl] 1,3-dioxo-2-prop-2-enylisoindole-5-carboxylate.
| Compound Name | [2-[[(3S)-1,1-dioxothiolan-3-yl]-methylamino]-2-oxoethyl] 1,3-dioxo-2-prop-2-enylisoindole-5-carboxylate |
|---|---|
| PubChem CID | 41179156 |
| Molecular Formula | C19H20N2O7S |
| Molecular Weight | 420.44 g/mol |
| Exact Mass | 420.10 |
| IUPAC Name | [2-[[(3S)-1,1-dioxothiolan-3-yl]-methylamino]-2-oxoethyl] 1,3-dioxo-2-prop-2-enylisoindole-5-carboxylate |
| SMILES | C=CCN1C(=O)c2ccc(C(=O)OCC(=O)N(C)[C@H]3CCS(=O)(=O)C3)cc2C1=O |
| InChI | InChI=1S/C19H20N2O7S/c1-3-7-21-17(23)14-5-4-12(9-15(14)18(21)24)19(25)28-10-16(22)20(2)13-6-8-29(26,27)11-13/h3-5,9,13H,1,6-8,10-11H2,2H3/t13-/m0/s1 |
| InChIKey | XHKRDROHAZNHRY-ZDUSSCGKSA-N |
| XLogP | 0.27 |
| TPSA | 118.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.44 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|