C16H17BrN2O5S — CID 25353996
3-(5-bromo-1,3-dioxoisoindol-2-yl)-N-[(3R)-1,1-dioxothiolan-3-yl]-N-methylpropanamide (PubChem CID 25353996) has the molecular formula C16H17BrN2O5S and a molecular weight of 429.29 g/mol. Its IUPAC name is 3-(5-bromo-1,3-dioxoisoindol-2-yl)-N-[(3R)-1,1-dioxothiolan-3-yl]-N-methylpropanamide.
| Compound Name | 3-(5-bromo-1,3-dioxoisoindol-2-yl)-N-[(3R)-1,1-dioxothiolan-3-yl]-N-methylpropanamide |
|---|---|
| PubChem CID | 25353996 |
| Molecular Formula | C16H17BrN2O5S |
| Molecular Weight | 429.29 g/mol |
| Exact Mass | 428.00 |
| IUPAC Name | 3-(5-bromo-1,3-dioxoisoindol-2-yl)-N-[(3R)-1,1-dioxothiolan-3-yl]-N-methylpropanamide |
| SMILES | CN(C(=O)CCN1C(=O)c2ccc(Br)cc2C1=O)[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C16H17BrN2O5S/c1-18(11-5-7-25(23,24)9-11)14(20)4-6-19-15(21)12-3-2-10(17)8-13(12)16(19)22/h2-3,8,11H,4-7,9H2,1H3/t11-/m1/s1 |
| InChIKey | HJKSFCBMYVOBJN-LLVKDONJSA-N |
| XLogP | 1.08 |
| TPSA | 91.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.29 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|