C23H24N2O5S — CID 41409415
3-(1,3-dioxoisoindol-2-yl)-N-[(3S)-1,1-dioxothiolan-3-yl]-N-(2-phenylethyl)propanamide (PubChem CID 41409415) has the molecular formula C23H24N2O5S and a molecular weight of 440.52 g/mol. Its IUPAC name is 3-(1,3-dioxoisoindol-2-yl)-N-[(3S)-1,1-dioxothiolan-3-yl]-N-(2-phenylethyl)propanamide.
| Compound Name | 3-(1,3-dioxoisoindol-2-yl)-N-[(3S)-1,1-dioxothiolan-3-yl]-N-(2-phenylethyl)propanamide |
|---|---|
| PubChem CID | 41409415 |
| Molecular Formula | C23H24N2O5S |
| Molecular Weight | 440.52 g/mol |
| Exact Mass | 440.14 |
| IUPAC Name | 3-(1,3-dioxoisoindol-2-yl)-N-[(3S)-1,1-dioxothiolan-3-yl]-N-(2-phenylethyl)propanamide |
| SMILES | O=C1c2ccccc2C(=O)N1CCC(=O)N(CCc1ccccc1)[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C23H24N2O5S/c26-21(11-14-25-22(27)19-8-4-5-9-20(19)23(25)28)24(18-12-15-31(29,30)16-18)13-10-17-6-2-1-3-7-17/h1-9,18H,10-16H2/t18-/m0/s1 |
| InChIKey | KLUZRGIEQSSQPB-SFHVURJKSA-N |
| XLogP | 1.93 |
| TPSA | 91.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.52 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|