C20H23NO4S — CID 18593889
N-(1,1-dioxothiolan-3-yl)-3-methoxy-N-(2-phenylethyl)benzamide (PubChem CID 18593889) has the molecular formula C20H23NO4S and a molecular weight of 373.47 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-3-methoxy-N-(2-phenylethyl)benzamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-3-methoxy-N-(2-phenylethyl)benzamide |
|---|---|
| PubChem CID | 18593889 |
| Molecular Formula | C20H23NO4S |
| Molecular Weight | 373.47 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-3-methoxy-N-(2-phenylethyl)benzamide |
| SMILES | COc1cccc(C(=O)N(CCc2ccccc2)C2CCS(=O)(=O)C2)c1 |
| InChI | InChI=1S/C20H23NO4S/c1-25-19-9-5-8-17(14-19)20(22)21(18-11-13-26(23,24)15-18)12-10-16-6-3-2-4-7-16/h2-9,14,18H,10-13,15H2,1H3 |
| InChIKey | DPCKGEOLPCRKKI-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.47 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |