C14H19NO4S — CID 18155646
N-(1,1-dioxothiolan-3-yl)-N-ethyl-3-methoxybenzamide (PubChem CID 18155646) has the molecular formula C14H19NO4S and a molecular weight of 297.38 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-N-ethyl-3-methoxybenzamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-N-ethyl-3-methoxybenzamide |
|---|---|
| PubChem CID | 18155646 |
| Molecular Formula | C14H19NO4S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-N-ethyl-3-methoxybenzamide |
| SMILES | CCN(C(=O)c1cccc(OC)c1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C14H19NO4S/c1-3-15(12-7-8-20(17,18)10-12)14(16)11-5-4-6-13(9-11)19-2/h4-6,9,12H,3,7-8,10H2,1-2H3 |
| InChIKey | HNQQAUQZFLRXTI-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |