C14H19NO4S — CID 60838540
2-[(1,1-dioxothiolan-3-yl)-(2-phenylethyl)amino]acetic acid (PubChem CID 60838540) has the molecular formula C14H19NO4S and a molecular weight of 297.38 g/mol. Its IUPAC name is 2-[(1,1-dioxothiolan-3-yl)-(2-phenylethyl)amino]acetic acid.
| Compound Name | 2-[(1,1-dioxothiolan-3-yl)-(2-phenylethyl)amino]acetic acid |
|---|---|
| PubChem CID | 60838540 |
| Molecular Formula | C14H19NO4S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | 2-[(1,1-dioxothiolan-3-yl)-(2-phenylethyl)amino]acetic acid |
| SMILES | O=C(O)CN(CCc1ccccc1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C14H19NO4S/c16-14(17)10-15(13-7-9-20(18,19)11-13)8-6-12-4-2-1-3-5-12/h1-5,13H,6-11H2,(H,16,17) |
| InChIKey | HUUVBVSUERTPCR-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |