C13H25NO4S — CID 60840580
2-[(1,1-dioxothiolan-3-yl)-heptylamino]acetic acid (PubChem CID 60840580) has the molecular formula C13H25NO4S and a molecular weight of 291.41 g/mol. Its IUPAC name is 2-[(1,1-dioxothiolan-3-yl)-heptylamino]acetic acid.
| Compound Name | 2-[(1,1-dioxothiolan-3-yl)-heptylamino]acetic acid |
|---|---|
| PubChem CID | 60840580 |
| Molecular Formula | C13H25NO4S |
| Molecular Weight | 291.41 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | 2-[(1,1-dioxothiolan-3-yl)-heptylamino]acetic acid |
| SMILES | CCCCCCCN(CC(=O)O)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H25NO4S/c1-2-3-4-5-6-8-14(10-13(15)16)12-7-9-19(17,18)11-12/h12H,2-11H2,1H3,(H,15,16) |
| InChIKey | XRYQRBJUOMRBCY-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.41 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|