2-[(1,1-dioxothiolan-3-yl)-heptylamino]acetic acid

C13H25NO4S — CID 60840580

IUPAC2-[(1,1-dioxothiolan-3-yl)-heptylamino]acetic acid
SMILESCCCCCCCN(CC(=O)O)C1CCS(=O)(=O)C1
InChIInChI=1S/C13H25NO4S/c1-2-3-4-5-6-8-14(10-13(15)16)12-7-9-19(17,18)11-12/h12H,2-11H2,1H3,(H,15,16)
InChIKeyXRYQRBJUOMRBCY-UHFFFAOYSA-N
MW291.41 g/mol
LogP1.53
Rot. Bonds9

About 2-[(1,1-dioxothiolan-3-yl)-heptylamino]acetic acid

2-[(1,1-dioxothiolan-3-yl)-heptylamino]acetic acid (PubChem CID 60840580) has the molecular formula C13H25NO4S and a molecular weight of 291.41 g/mol. Its IUPAC name is 2-[(1,1-dioxothiolan-3-yl)-heptylamino]acetic acid.

Molecular Properties

Compound Name2-[(1,1-dioxothiolan-3-yl)-heptylamino]acetic acid
PubChem CID60840580
Molecular FormulaC13H25NO4S
Molecular Weight291.41 g/mol
Exact Mass291.15
IUPAC Name2-[(1,1-dioxothiolan-3-yl)-heptylamino]acetic acid
SMILESCCCCCCCN(CC(=O)O)C1CCS(=O)(=O)C1
InChIInChI=1S/C13H25NO4S/c1-2-3-4-5-6-8-14(10-13(15)16)12-7-9-19(17,18)11-12/h12H,2-11H2,1H3,(H,15,16)
InChIKeyXRYQRBJUOMRBCY-UHFFFAOYSA-N
XLogP1.53
TPSA74.68 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds9
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500291.41
LogP ≤ 51.53
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 2-[(1,1-dioxothiolan-3-yl)-heptylamino]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(1,1-dioxothiolan-3-yl)-heptylamino]acetic acid?
The IUPAC name of 2-[(1,1-dioxothiolan-3-yl)-heptylamino]acetic acid (CID 60840580) is 2-[(1,1-dioxothiolan-3-yl)-heptylamino]acetic acid.
What is the SMILES notation for 2-[(1,1-dioxothiolan-3-yl)-heptylamino]acetic acid?
The canonical SMILES for 2-[(1,1-dioxothiolan-3-yl)-heptylamino]acetic acid is CCCCCCCN(CC(=O)O)C1CCS(=O)(=O)C1.
What is the InChIKey of 2-[(1,1-dioxothiolan-3-yl)-heptylamino]acetic acid?
The InChIKey is XRYQRBJUOMRBCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25NO4S/c1-2-3-4-5-6-8-14(10-13(15)16)12-7-9-19(17,18)11-12/h12H,2-11H2,1H3,(H,15,16).
What are the key properties of 2-[(1,1-dioxothiolan-3-yl)-heptylamino]acetic acid?
2-[(1,1-dioxothiolan-3-yl)-heptylamino]acetic acid has a molecular weight of 291.41 g/mol, XLogP of 1.53, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1,1-dioxothiolan-3-yl)-heptylamino]acetic acid is sourced from PubChem (CID 60840580), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).