C12H23NO2S — CID 78823365
N-butyl-N-(2-methylprop-2-enyl)-1,1-dioxothiolan-3-amine (PubChem CID 78823365) has the molecular formula C12H23NO2S and a molecular weight of 245.39 g/mol. Its IUPAC name is N-butyl-N-(2-methylprop-2-enyl)-1,1-dioxothiolan-3-amine.
| Compound Name | N-butyl-N-(2-methylprop-2-enyl)-1,1-dioxothiolan-3-amine |
|---|---|
| PubChem CID | 78823365 |
| Molecular Formula | C12H23NO2S |
| Molecular Weight | 245.39 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | N-butyl-N-(2-methylprop-2-enyl)-1,1-dioxothiolan-3-amine |
| SMILES | C=C(C)CN(CCCC)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H23NO2S/c1-4-5-7-13(9-11(2)3)12-6-8-16(14,15)10-12/h12H,2,4-10H2,1,3H3 |
| InChIKey | ABMPJHIOPWUCQD-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.39 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|