C11H20BrNO3S — CID 71912012
N-(2-bromoprop-2-enyl)-N-(3-methoxypropyl)-1,1-dioxothiolan-3-amine (PubChem CID 71912012) has the molecular formula C11H20BrNO3S and a molecular weight of 326.26 g/mol. Its IUPAC name is N-(2-bromoprop-2-enyl)-N-(3-methoxypropyl)-1,1-dioxothiolan-3-amine.
| Compound Name | N-(2-bromoprop-2-enyl)-N-(3-methoxypropyl)-1,1-dioxothiolan-3-amine |
|---|---|
| PubChem CID | 71912012 |
| Molecular Formula | C11H20BrNO3S |
| Molecular Weight | 326.26 g/mol |
| Exact Mass | 325.03 |
| IUPAC Name | N-(2-bromoprop-2-enyl)-N-(3-methoxypropyl)-1,1-dioxothiolan-3-amine |
| SMILES | C=C(Br)CN(CCCOC)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C11H20BrNO3S/c1-10(12)8-13(5-3-6-16-2)11-4-7-17(14,15)9-11/h11H,1,3-9H2,2H3 |
| InChIKey | VUQSIDDEJFATIH-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.26 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|