C13H26N2O6S2 — CID 113149470
N-(1,1-dioxothiolan-3-yl)-N-ethyl-2-[3-methoxypropyl(methylsulfonyl)amino]acetamide (PubChem CID 113149470) has the molecular formula C13H26N2O6S2 and a molecular weight of 370.49 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-N-ethyl-2-[3-methoxypropyl(methylsulfonyl)amino]acetamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-N-ethyl-2-[3-methoxypropyl(methylsulfonyl)amino]acetamide |
|---|---|
| PubChem CID | 113149470 |
| Molecular Formula | C13H26N2O6S2 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-N-ethyl-2-[3-methoxypropyl(methylsulfonyl)amino]acetamide |
| SMILES | CCN(C(=O)CN(CCCOC)S(C)(=O)=O)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H26N2O6S2/c1-4-15(12-6-9-23(19,20)11-12)13(16)10-14(22(3,17)18)7-5-8-21-2/h12H,4-11H2,1-3H3 |
| InChIKey | KJHFRQYSFPMEBA-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 101.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|