C13H26N2O5S2 — CID 113153415
N-(1,1-dioxothiolan-3-yl)-N-methyl-2-[methylsulfonyl(pentyl)amino]acetamide (PubChem CID 113153415) has the molecular formula C13H26N2O5S2 and a molecular weight of 354.49 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-N-methyl-2-[methylsulfonyl(pentyl)amino]acetamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-N-methyl-2-[methylsulfonyl(pentyl)amino]acetamide |
|---|---|
| PubChem CID | 113153415 |
| Molecular Formula | C13H26N2O5S2 |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.13 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-N-methyl-2-[methylsulfonyl(pentyl)amino]acetamide |
| SMILES | CCCCCN(CC(=O)N(C)C1CCS(=O)(=O)C1)S(C)(=O)=O |
| InChI | InChI=1S/C13H26N2O5S2/c1-4-5-6-8-15(21(3,17)18)10-13(16)14(2)12-7-9-22(19,20)11-12/h12H,4-11H2,1-3H3 |
| InChIKey | UEMBABNBFHOODR-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 91.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|