C11H22N2O6S2 — CID 113149462
N-(1,1-dioxothiolan-3-yl)-2-[3-methoxypropyl(methylsulfonyl)amino]acetamide (PubChem CID 113149462) has the molecular formula C11H22N2O6S2 and a molecular weight of 342.44 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-2-[3-methoxypropyl(methylsulfonyl)amino]acetamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-2-[3-methoxypropyl(methylsulfonyl)amino]acetamide |
|---|---|
| PubChem CID | 113149462 |
| Molecular Formula | C11H22N2O6S2 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-2-[3-methoxypropyl(methylsulfonyl)amino]acetamide |
| SMILES | COCCCN(CC(=O)NC1CCS(=O)(=O)C1)S(C)(=O)=O |
| InChI | InChI=1S/C11H22N2O6S2/c1-19-6-3-5-13(20(2,15)16)8-11(14)12-10-4-7-21(17,18)9-10/h10H,3-9H2,1-2H3,(H,12,14) |
| InChIKey | NDFNCJODMLQCJX-UHFFFAOYSA-N |
| XLogP | -1.41 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|