C12H24N2O5S2 — CID 113136680
3-[butyl(methylsulfonyl)amino]-N-(1,1-dioxothiolan-3-yl)propanamide (PubChem CID 113136680) has the molecular formula C12H24N2O5S2 and a molecular weight of 340.47 g/mol. Its IUPAC name is 3-[butyl(methylsulfonyl)amino]-N-(1,1-dioxothiolan-3-yl)propanamide.
| Compound Name | 3-[butyl(methylsulfonyl)amino]-N-(1,1-dioxothiolan-3-yl)propanamide |
|---|---|
| PubChem CID | 113136680 |
| Molecular Formula | C12H24N2O5S2 |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | 3-[butyl(methylsulfonyl)amino]-N-(1,1-dioxothiolan-3-yl)propanamide |
| SMILES | CCCCN(CCC(=O)NC1CCS(=O)(=O)C1)S(C)(=O)=O |
| InChI | InChI=1S/C12H24N2O5S2/c1-3-4-7-14(20(2,16)17)8-5-12(15)13-11-6-9-21(18,19)10-11/h11H,3-10H2,1-2H3,(H,13,15) |
| InChIKey | MMIMLIHJIQPMTN-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |