C16H33N5O4S — CID 111652236
N-(1,1-dioxothiolan-3-yl)-3-[[N-[2-[3-methoxypropyl(methyl)amino]ethyl]-N'-methylcarbamimidoyl]amino]propanamide (PubChem CID 111652236) has the molecular formula C16H33N5O4S and a molecular weight of 391.54 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-3-[[N-[2-[3-methoxypropyl(methyl)amino]ethyl]-N'-methylcarbamimidoyl]amino]propanamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-3-[[N-[2-[3-methoxypropyl(methyl)amino]ethyl]-N'-methylcarbamimidoyl]amino]propanamide |
|---|---|
| PubChem CID | 111652236 |
| Molecular Formula | C16H33N5O4S |
| Molecular Weight | 391.54 g/mol |
| Exact Mass | 391.23 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-3-[[N-[2-[3-methoxypropyl(methyl)amino]ethyl]-N'-methylcarbamimidoyl]amino]propanamide |
| SMILES | C/N=C(/NCCC(=O)NC1CCS(=O)(=O)C1)NCCN(C)CCCOC |
| InChI | InChI=1S/C16H33N5O4S/c1-17-16(19-8-10-21(2)9-4-11-25-3)18-7-5-15(22)20-14-6-12-26(23,24)13-14/h14H,4-13H2,1-3H3,(H,20,22)(H2,17,18,19) |
| InChIKey | BFRYREOEDTZYQT-UHFFFAOYSA-N |
| XLogP | -1.19 |
| TPSA | 112.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.54 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|