C19H30N4O4S — CID 111589504
N-(1,1-dioxothiolan-3-yl)-3-[[N-[2-(3-methoxy-4-methylphenyl)ethyl]-N'-methylcarbamimidoyl]amino]propanamide (PubChem CID 111589504) has the molecular formula C19H30N4O4S and a molecular weight of 410.54 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-3-[[N-[2-(3-methoxy-4-methylphenyl)ethyl]-N'-methylcarbamimidoyl]amino]propanamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-3-[[N-[2-(3-methoxy-4-methylphenyl)ethyl]-N'-methylcarbamimidoyl]amino]propanamide |
|---|---|
| PubChem CID | 111589504 |
| Molecular Formula | C19H30N4O4S |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-3-[[N-[2-(3-methoxy-4-methylphenyl)ethyl]-N'-methylcarbamimidoyl]amino]propanamide |
| SMILES | C/N=C(\NCCC(=O)NC1CCS(=O)(=O)C1)NCCc1ccc(C)c(OC)c1 |
| InChI | InChI=1S/C19H30N4O4S/c1-14-4-5-15(12-17(14)27-3)6-9-21-19(20-2)22-10-7-18(24)23-16-8-11-28(25,26)13-16/h4-5,12,16H,6-11,13H2,1-3H3,(H,23,24)(H2,20,21,22) |
| InChIKey | VRAOEZFDSSATBS-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 108.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|