C17H26N2O5S — CID 109026297
3-[2-(3,4-dimethoxyphenyl)ethylamino]-N-(1,1-dioxothiolan-3-yl)propanamide (PubChem CID 109026297) has the molecular formula C17H26N2O5S and a molecular weight of 370.47 g/mol. Its IUPAC name is 3-[2-(3,4-dimethoxyphenyl)ethylamino]-N-(1,1-dioxothiolan-3-yl)propanamide.
| Compound Name | 3-[2-(3,4-dimethoxyphenyl)ethylamino]-N-(1,1-dioxothiolan-3-yl)propanamide |
|---|---|
| PubChem CID | 109026297 |
| Molecular Formula | C17H26N2O5S |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | 3-[2-(3,4-dimethoxyphenyl)ethylamino]-N-(1,1-dioxothiolan-3-yl)propanamide |
| SMILES | COc1ccc(CCNCCC(=O)NC2CCS(=O)(=O)C2)cc1OC |
| InChI | InChI=1S/C17H26N2O5S/c1-23-15-4-3-13(11-16(15)24-2)5-8-18-9-6-17(20)19-14-7-10-25(21,22)12-14/h3-4,11,14,18H,5-10,12H2,1-2H3,(H,19,20) |
| InChIKey | NDRLWNYRZUJKRZ-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|