C15H21NO5S — CID 110770066
2-(4,5-dimethoxy-2-methylphenyl)-N-(1,1-dioxothiolan-3-yl)acetamide (PubChem CID 110770066) has the molecular formula C15H21NO5S and a molecular weight of 327.40 g/mol. Its IUPAC name is 2-(4,5-dimethoxy-2-methylphenyl)-N-(1,1-dioxothiolan-3-yl)acetamide.
| Compound Name | 2-(4,5-dimethoxy-2-methylphenyl)-N-(1,1-dioxothiolan-3-yl)acetamide |
|---|---|
| PubChem CID | 110770066 |
| Molecular Formula | C15H21NO5S |
| Molecular Weight | 327.40 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | 2-(4,5-dimethoxy-2-methylphenyl)-N-(1,1-dioxothiolan-3-yl)acetamide |
| SMILES | COc1cc(C)c(CC(=O)NC2CCS(=O)(=O)C2)cc1OC |
| InChI | InChI=1S/C15H21NO5S/c1-10-6-13(20-2)14(21-3)7-11(10)8-15(17)16-12-4-5-22(18,19)9-12/h6-7,12H,4-5,8-9H2,1-3H3,(H,16,17) |
| InChIKey | ZXLUBQNLTAXPHC-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.40 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |