C14H19NO5S — CID 46560159
N-(1,1-dioxothiolan-3-yl)-3,5-dimethoxy-4-methylbenzamide (PubChem CID 46560159) has the molecular formula C14H19NO5S and a molecular weight of 313.38 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-3,5-dimethoxy-4-methylbenzamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-3,5-dimethoxy-4-methylbenzamide |
|---|---|
| PubChem CID | 46560159 |
| Molecular Formula | C14H19NO5S |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-3,5-dimethoxy-4-methylbenzamide |
| SMILES | COc1cc(C(=O)NC2CCS(=O)(=O)C2)cc(OC)c1C |
| InChI | InChI=1S/C14H19NO5S/c1-9-12(19-2)6-10(7-13(9)20-3)14(16)15-11-4-5-21(17,18)8-11/h6-7,11H,4-5,8H2,1-3H3,(H,15,16) |
| InChIKey | DXSDKNHMHXXSIU-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |