C15H21NO4S — CID 110761451
N-(1,1-dioxothiolan-3-yl)-2-methoxy-5-propan-2-ylbenzamide (PubChem CID 110761451) has the molecular formula C15H21NO4S and a molecular weight of 311.40 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-2-methoxy-5-propan-2-ylbenzamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-2-methoxy-5-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 110761451 |
| Molecular Formula | C15H21NO4S |
| Molecular Weight | 311.40 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-2-methoxy-5-propan-2-ylbenzamide |
| SMILES | COc1ccc(C(C)C)cc1C(=O)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C15H21NO4S/c1-10(2)11-4-5-14(20-3)13(8-11)15(17)16-12-6-7-21(18,19)9-12/h4-5,8,10,12H,6-7,9H2,1-3H3,(H,16,17) |
| InChIKey | WOSOWTQYLZUKAM-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.40 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |