C16H20N2O6S — CID 113206751
N-(1,1-dioxothiolan-3-yl)-4,5,6-trimethoxy-1H-indole-3-carboxamide (PubChem CID 113206751) has the molecular formula C16H20N2O6S and a molecular weight of 368.41 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-4,5,6-trimethoxy-1H-indole-3-carboxamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-4,5,6-trimethoxy-1H-indole-3-carboxamide |
|---|---|
| PubChem CID | 113206751 |
| Molecular Formula | C16H20N2O6S |
| Molecular Weight | 368.41 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-4,5,6-trimethoxy-1H-indole-3-carboxamide |
| SMILES | COc1cc2[nH]cc(C(=O)NC3CCS(=O)(=O)C3)c2c(OC)c1OC |
| InChI | InChI=1S/C16H20N2O6S/c1-22-12-6-11-13(15(24-3)14(12)23-2)10(7-17-11)16(19)18-9-4-5-25(20,21)8-9/h6-7,9,17H,4-5,8H2,1-3H3,(H,18,19) |
| InChIKey | XHNDWXVKPUNAKS-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 106.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.41 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |