C15H18N2O4S — CID 110852767
N-(1,1-dioxothiolan-3-yl)-2-(6-methoxy-1H-indol-3-yl)acetamide (PubChem CID 110852767) has the molecular formula C15H18N2O4S and a molecular weight of 322.39 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-2-(6-methoxy-1H-indol-3-yl)acetamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-2-(6-methoxy-1H-indol-3-yl)acetamide |
|---|---|
| PubChem CID | 110852767 |
| Molecular Formula | C15H18N2O4S |
| Molecular Weight | 322.39 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-2-(6-methoxy-1H-indol-3-yl)acetamide |
| SMILES | COc1ccc2c(CC(=O)NC3CCS(=O)(=O)C3)c[nH]c2c1 |
| InChI | InChI=1S/C15H18N2O4S/c1-21-12-2-3-13-10(8-16-14(13)7-12)6-15(18)17-11-4-5-22(19,20)9-11/h2-3,7-8,11,16H,4-6,9H2,1H3,(H,17,18) |
| InChIKey | GGKYUQRRPQNSPB-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 88.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.39 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |