C13H19NO4S — CID 43177543
N-[(2,4-dimethoxyphenyl)methyl]-1,1-dioxothiolan-3-amine (PubChem CID 43177543) has the molecular formula C13H19NO4S and a molecular weight of 285.36 g/mol. Its IUPAC name is N-[(2,4-dimethoxyphenyl)methyl]-1,1-dioxothiolan-3-amine.
| Compound Name | N-[(2,4-dimethoxyphenyl)methyl]-1,1-dioxothiolan-3-amine |
|---|---|
| PubChem CID | 43177543 |
| Molecular Formula | C13H19NO4S |
| Molecular Weight | 285.36 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | N-[(2,4-dimethoxyphenyl)methyl]-1,1-dioxothiolan-3-amine |
| SMILES | COc1ccc(CNC2CCS(=O)(=O)C2)c(OC)c1 |
| InChI | InChI=1S/C13H19NO4S/c1-17-12-4-3-10(13(7-12)18-2)8-14-11-5-6-19(15,16)9-11/h3-4,7,11,14H,5-6,8-9H2,1-2H3 |
| InChIKey | HOFGZOPIJWCTCQ-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.36 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |