C14H21NO4S — CID 63924086
N-[(2,5-dimethoxyphenyl)methyl]-1,1-dioxothian-3-amine (PubChem CID 63924086) has the molecular formula C14H21NO4S and a molecular weight of 299.39 g/mol. Its IUPAC name is N-[(2,5-dimethoxyphenyl)methyl]-1,1-dioxothian-3-amine.
| Compound Name | N-[(2,5-dimethoxyphenyl)methyl]-1,1-dioxothian-3-amine |
|---|---|
| PubChem CID | 63924086 |
| Molecular Formula | C14H21NO4S |
| Molecular Weight | 299.39 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | N-[(2,5-dimethoxyphenyl)methyl]-1,1-dioxothian-3-amine |
| SMILES | COc1ccc(OC)c(CNC2CCCS(=O)(=O)C2)c1 |
| InChI | InChI=1S/C14H21NO4S/c1-18-13-5-6-14(19-2)11(8-13)9-15-12-4-3-7-20(16,17)10-12/h5-6,8,12,15H,3-4,7,9-10H2,1-2H3 |
| InChIKey | HGOMOYUHSHAOCM-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.39 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |