C14H21NO2S — CID 115578053
N-[(2,5-dimethoxyphenyl)methyl]thian-4-amine (PubChem CID 115578053) has the molecular formula C14H21NO2S and a molecular weight of 267.39 g/mol. Its IUPAC name is N-[(2,5-dimethoxyphenyl)methyl]thian-4-amine.
| Compound Name | N-[(2,5-dimethoxyphenyl)methyl]thian-4-amine |
|---|---|
| PubChem CID | 115578053 |
| Molecular Formula | C14H21NO2S |
| Molecular Weight | 267.39 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | N-[(2,5-dimethoxyphenyl)methyl]thian-4-amine |
| SMILES | COc1ccc(OC)c(CNC2CCSCC2)c1 |
| InChI | InChI=1S/C14H21NO2S/c1-16-13-3-4-14(17-2)11(9-13)10-15-12-5-7-18-8-6-12/h3-4,9,12,15H,5-8,10H2,1-2H3 |
| InChIKey | BKWSCPBDRXVBIK-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.39 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |