C14H22N2O2 — CID 112690313
N'-cyclopropyl-N-[(2,5-dimethoxyphenyl)methyl]ethane-1,2-diamine (PubChem CID 112690313) has the molecular formula C14H22N2O2 and a molecular weight of 250.34 g/mol. Its IUPAC name is N'-cyclopropyl-N-[(2,5-dimethoxyphenyl)methyl]ethane-1,2-diamine.
| Compound Name | N'-cyclopropyl-N-[(2,5-dimethoxyphenyl)methyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 112690313 |
| Molecular Formula | C14H22N2O2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | N'-cyclopropyl-N-[(2,5-dimethoxyphenyl)methyl]ethane-1,2-diamine |
| SMILES | COc1ccc(OC)c(CNCCNC2CC2)c1 |
| InChI | InChI=1S/C14H22N2O2/c1-17-13-5-6-14(18-2)11(9-13)10-15-7-8-16-12-3-4-12/h5-6,9,12,15-16H,3-4,7-8,10H2,1-2H3 |
| InChIKey | BCPKMBKAGFQMJL-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|