C13H19NO2 — CID 62801628
N-[2-(2,4-dimethoxyphenyl)ethyl]cyclopropanamine (PubChem CID 62801628) has the molecular formula C13H19NO2 and a molecular weight of 221.30 g/mol. Its IUPAC name is N-[2-(2,4-dimethoxyphenyl)ethyl]cyclopropanamine.
| Compound Name | N-[2-(2,4-dimethoxyphenyl)ethyl]cyclopropanamine |
|---|---|
| PubChem CID | 62801628 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | N-[2-(2,4-dimethoxyphenyl)ethyl]cyclopropanamine |
| SMILES | COc1ccc(CCNC2CC2)c(OC)c1 |
| InChI | InChI=1S/C13H19NO2/c1-15-12-6-3-10(13(9-12)16-2)7-8-14-11-4-5-11/h3,6,9,11,14H,4-5,7-8H2,1-2H3 |
| InChIKey | BDRZXUBMCYCTDO-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |