C13H17Br2NO3S — CID 63922914
N-[(3,5-dibromo-2-methoxyphenyl)methyl]-1,1-dioxothian-3-amine (PubChem CID 63922914) has the molecular formula C13H17Br2NO3S and a molecular weight of 427.16 g/mol. Its IUPAC name is N-[(3,5-dibromo-2-methoxyphenyl)methyl]-1,1-dioxothian-3-amine.
| Compound Name | N-[(3,5-dibromo-2-methoxyphenyl)methyl]-1,1-dioxothian-3-amine |
|---|---|
| PubChem CID | 63922914 |
| Molecular Formula | C13H17Br2NO3S |
| Molecular Weight | 427.16 g/mol |
| Exact Mass | 424.93 |
| IUPAC Name | N-[(3,5-dibromo-2-methoxyphenyl)methyl]-1,1-dioxothian-3-amine |
| SMILES | COc1c(Br)cc(Br)cc1CNC1CCCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H17Br2NO3S/c1-19-13-9(5-10(14)6-12(13)15)7-16-11-3-2-4-20(17,18)8-11/h5-6,11,16H,2-4,7-8H2,1H3 |
| InChIKey | BQAVJBHXJWDTSJ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.16 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |