C12H15Br2NO3S — CID 43222614
N-[(3,5-dibromo-2-methoxyphenyl)methyl]-1,1-dioxothiolan-3-amine (PubChem CID 43222614) has the molecular formula C12H15Br2NO3S and a molecular weight of 413.13 g/mol. Its IUPAC name is N-[(3,5-dibromo-2-methoxyphenyl)methyl]-1,1-dioxothiolan-3-amine.
| Compound Name | N-[(3,5-dibromo-2-methoxyphenyl)methyl]-1,1-dioxothiolan-3-amine |
|---|---|
| PubChem CID | 43222614 |
| Molecular Formula | C12H15Br2NO3S |
| Molecular Weight | 413.13 g/mol |
| Exact Mass | 410.91 |
| IUPAC Name | N-[(3,5-dibromo-2-methoxyphenyl)methyl]-1,1-dioxothiolan-3-amine |
| SMILES | COc1c(Br)cc(Br)cc1CNC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H15Br2NO3S/c1-18-12-8(4-9(13)5-11(12)14)6-15-10-2-3-19(16,17)7-10/h4-5,10,15H,2-3,6-7H2,1H3 |
| InChIKey | IXUMKRFMFKOEHZ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.13 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |