C10H12Br2N2O2S — CID 113393623
N-[(3,5-dibromo-2-pyridinyl)methyl]-1,1-dioxothiolan-3-amine (PubChem CID 113393623) has the molecular formula C10H12Br2N2O2S and a molecular weight of 384.09 g/mol. Its IUPAC name is N-[(3,5-dibromo-2-pyridinyl)methyl]-1,1-dioxothiolan-3-amine.
| Compound Name | N-[(3,5-dibromo-2-pyridinyl)methyl]-1,1-dioxothiolan-3-amine |
|---|---|
| PubChem CID | 113393623 |
| Molecular Formula | C10H12Br2N2O2S |
| Molecular Weight | 384.09 g/mol |
| Exact Mass | 381.90 |
| IUPAC Name | N-[(3,5-dibromo-2-pyridinyl)methyl]-1,1-dioxothiolan-3-amine |
| SMILES | O=S1(=O)CCC(NCc2ncc(Br)cc2Br)C1 |
| InChI | InChI=1S/C10H12Br2N2O2S/c11-7-3-9(12)10(14-4-7)5-13-8-1-2-17(15,16)6-8/h3-4,8,13H,1-2,5-6H2 |
| InChIKey | URTIHMIEBINJJF-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.09 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |