C11H16N2O2S — CID 62996716
N-[(6-methyl-3-pyridinyl)methyl]-1,1-dioxothiolan-3-amine (PubChem CID 62996716) has the molecular formula C11H16N2O2S and a molecular weight of 240.33 g/mol. Its IUPAC name is N-[(6-methyl-3-pyridinyl)methyl]-1,1-dioxothiolan-3-amine.
| Compound Name | N-[(6-methyl-3-pyridinyl)methyl]-1,1-dioxothiolan-3-amine |
|---|---|
| PubChem CID | 62996716 |
| Molecular Formula | C11H16N2O2S |
| Molecular Weight | 240.33 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | N-[(6-methyl-3-pyridinyl)methyl]-1,1-dioxothiolan-3-amine |
| SMILES | Cc1ccc(CNC2CCS(=O)(=O)C2)cn1 |
| InChI | InChI=1S/C11H16N2O2S/c1-9-2-3-10(6-12-9)7-13-11-4-5-16(14,15)8-11/h2-3,6,11,13H,4-5,7-8H2,1H3 |
| InChIKey | YFOJNNAWEYMRPL-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.33 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |