C10H14N2 — CID 43163855
N-[(6-methyl-3-pyridinyl)methyl]cyclopropanamine (PubChem CID 43163855) has the molecular formula C10H14N2 and a molecular weight of 162.24 g/mol. Its IUPAC name is N-[(6-methyl-3-pyridinyl)methyl]cyclopropanamine.
| Compound Name | N-[(6-methyl-3-pyridinyl)methyl]cyclopropanamine |
|---|---|
| PubChem CID | 43163855 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | N-[(6-methyl-3-pyridinyl)methyl]cyclopropanamine |
| SMILES | Cc1ccc(CNC2CC2)cn1 |
| InChI | InChI=1S/C10H14N2/c1-8-2-3-9(6-11-8)7-12-10-4-5-10/h2-3,6,10,12H,4-5,7H2,1H3 |
| InChIKey | ZHZXTKHHFZWHJJ-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |