C11H18N2P2 — CID 155399172
N-[[6-[1,1-bis(phosphanyl)ethyl]-3-pyridinyl]methyl]cyclopropanamine (PubChem CID 155399172) has the molecular formula C11H18N2P2 and a molecular weight of 240.23 g/mol. Its IUPAC name is N-[[6-[1,1-bis(phosphanyl)ethyl]-3-pyridinyl]methyl]cyclopropanamine.
| Compound Name | N-[[6-[1,1-bis(phosphanyl)ethyl]-3-pyridinyl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 155399172 |
| Molecular Formula | C11H18N2P2 |
| Molecular Weight | 240.23 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | N-[[6-[1,1-bis(phosphanyl)ethyl]-3-pyridinyl]methyl]cyclopropanamine |
| SMILES | CC(P)(P)c1ccc(CNC2CC2)cn1 |
| InChI | InChI=1S/C11H18N2P2/c1-11(14,15)10-5-2-8(7-13-10)6-12-9-3-4-9/h2,5,7,9,12H,3-4,6,14-15H2,1H3 |
| InChIKey | NLHQYCNARSRUCP-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.23 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|