C9H11ClN2 — CID 53385515
N-[(6-chloro-3-pyridinyl)methyl]cyclopropanamine (PubChem CID 53385515) has the molecular formula C9H11ClN2 and a molecular weight of 182.65 g/mol. Its IUPAC name is N-[(6-chloro-3-pyridinyl)methyl]cyclopropanamine.
| Compound Name | N-[(6-chloro-3-pyridinyl)methyl]cyclopropanamine |
|---|---|
| PubChem CID | 53385515 |
| Molecular Formula | C9H11ClN2 |
| Molecular Weight | 182.65 g/mol |
| Exact Mass | 182.06 |
| IUPAC Name | N-[(6-chloro-3-pyridinyl)methyl]cyclopropanamine |
| SMILES | Clc1ccc(CNC2CC2)cn1 |
| InChI | InChI=1S/C9H11ClN2/c10-9-4-1-7(6-12-9)5-11-8-2-3-8/h1,4,6,8,11H,2-3,5H2 |
| InChIKey | AQFBPRSYDFQSPO-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.65 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|