C13H20Cl2N2 — CID 115584748
N-[(6-chloro-3-pyridinyl)methyl]-3-methylcyclohexan-1-amine;hydrochloride (PubChem CID 115584748) has the molecular formula C13H20Cl2N2 and a molecular weight of 275.22 g/mol. Its IUPAC name is N-[(6-chloro-3-pyridinyl)methyl]-3-methylcyclohexan-1-amine;hydrochloride.
| Compound Name | N-[(6-chloro-3-pyridinyl)methyl]-3-methylcyclohexan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 115584748 |
| Molecular Formula | C13H20Cl2N2 |
| Molecular Weight | 275.22 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | N-[(6-chloro-3-pyridinyl)methyl]-3-methylcyclohexan-1-amine;hydrochloride |
| SMILES | CC1CCCC(NCc2ccc(Cl)nc2)C1.Cl |
| InChI | InChI=1S/C13H19ClN2.ClH/c1-10-3-2-4-12(7-10)15-8-11-5-6-13(14)16-9-11;/h5-6,9-10,12,15H,2-4,7-8H2,1H3;1H |
| InChIKey | ZRLGKRUUIAWRNC-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.22 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|