C11H17Cl2N3 — CID 71639863
(3S)-N-[(6-chloro-3-pyridinyl)methyl]piperidin-3-amine;hydrochloride (PubChem CID 71639863) has the molecular formula C11H17Cl2N3 and a molecular weight of 262.18 g/mol. Its IUPAC name is (3S)-N-[(6-chloro-3-pyridinyl)methyl]piperidin-3-amine;hydrochloride.
| Compound Name | (3S)-N-[(6-chloro-3-pyridinyl)methyl]piperidin-3-amine;hydrochloride |
|---|---|
| PubChem CID | 71639863 |
| Molecular Formula | C11H17Cl2N3 |
| Molecular Weight | 262.18 g/mol |
| Exact Mass | 261.08 |
| IUPAC Name | (3S)-N-[(6-chloro-3-pyridinyl)methyl]piperidin-3-amine;hydrochloride |
| SMILES | Cl.Clc1ccc(CN[C@H]2CCCNC2)cn1 |
| InChI | InChI=1S/C11H16ClN3.ClH/c12-11-4-3-9(7-15-11)6-14-10-2-1-5-13-8-10;/h3-4,7,10,13-14H,1-2,5-6,8H2;1H/t10-;/m0./s1 |
| InChIKey | IRFXEKPWKONJMJ-PPHPATTJSA-N |
| XLogP | 2.00 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.18 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|