C12H18ClN3 — CID 86257637
2-(aminomethyl)-N-[(6-chloro-3-pyridinyl)methyl]cyclopentan-1-amine (PubChem CID 86257637) has the molecular formula C12H18ClN3 and a molecular weight of 239.75 g/mol. Its IUPAC name is 2-(aminomethyl)-N-[(6-chloro-3-pyridinyl)methyl]cyclopentan-1-amine.
| Compound Name | 2-(aminomethyl)-N-[(6-chloro-3-pyridinyl)methyl]cyclopentan-1-amine |
|---|---|
| PubChem CID | 86257637 |
| Molecular Formula | C12H18ClN3 |
| Molecular Weight | 239.75 g/mol |
| Exact Mass | 239.12 |
| IUPAC Name | 2-(aminomethyl)-N-[(6-chloro-3-pyridinyl)methyl]cyclopentan-1-amine |
| SMILES | NCC1CCCC1NCc1ccc(Cl)nc1 |
| InChI | InChI=1S/C12H18ClN3/c13-12-5-4-9(8-16-12)7-15-11-3-1-2-10(11)6-14/h4-5,8,10-11,15H,1-3,6-7,14H2 |
| InChIKey | GUHNBXGHKHHQCL-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.75 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|