C12H17ClN2 — CID 115117343
1-N-[(4-chlorophenyl)methyl]cyclopentane-1,2-diamine (PubChem CID 115117343) has the molecular formula C12H17ClN2 and a molecular weight of 224.73 g/mol. Its IUPAC name is 1-N-[(4-chlorophenyl)methyl]cyclopentane-1,2-diamine.
| Compound Name | 1-N-[(4-chlorophenyl)methyl]cyclopentane-1,2-diamine |
|---|---|
| PubChem CID | 115117343 |
| Molecular Formula | C12H17ClN2 |
| Molecular Weight | 224.73 g/mol |
| Exact Mass | 224.11 |
| IUPAC Name | 1-N-[(4-chlorophenyl)methyl]cyclopentane-1,2-diamine |
| SMILES | NC1CCCC1NCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H17ClN2/c13-10-6-4-9(5-7-10)8-15-12-3-1-2-11(12)14/h4-7,11-12,15H,1-3,8,14H2 |
| InChIKey | KEHNPCXDVOZHNT-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.73 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |